CAS 781656-64-2 appears in our catalog under these names: 2-(2,5-Dimethoxybenzenesulfonamido)acetic acid, 2-(2,5-Dimethoxybenzenesulfonamido)acetic acid, 95%, ([(2,5-Dimethoxyphenyl)sulfonyl]amino)acetic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg, 100mg.
2-[(2,5-dimethoxyphenyl)sulfonylamino]acetic acid (CAS 781656-64-2) is a chemical compound with the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. IUPAC name: 2-[(2,5-dimethoxyphenyl)sulfonylamino]acetic acid. InChIKey: YLNZXVFVJCUJEC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6S |
|---|---|
| Molecular weight | 275.28 g/mol |
| IUPAC name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]acetic acid |
| InChIKey | YLNZXVFVJCUJEC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)