CAS 1354949-93-1 appears in our catalog under these names: 3-Methanesulfonamido-4,5-dimethoxybenzoic acid, 95%, 3-Methanesulfonamido-4,5-dimethoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(methanesulfonamido)-4,5-dimethoxybenzoic acid (CAS 1354949-93-1) is a chemical compound with the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. IUPAC name: 3-(methanesulfonamido)-4,5-dimethoxybenzoic acid. InChIKey: KYWRGYORRNKLFJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6S |
|---|---|
| Molecular weight | 275.28 g/mol |
| IUPAC name | 3-(methanesulfonamido)-4,5-dimethoxybenzoic acid |
| InChIKey | KYWRGYORRNKLFJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)NS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)