Products 1134124-17-6
CAS 1134124-17-6 is the registry number for (R)-Etodolac-d4. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
2-[(1R)-3,3,4,4-tetradeuterio-1,8-diethyl-9H-pyrano[3,4-b]indol-1-yl]acetic acid (CAS 1134124-17-6) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 291.38 g/mol. IUPAC name: 2-[(1R)-3,3,4,4-tetradeuterio-1,8-diethyl-9H-pyrano[3,4-b]indol-1-yl]acetic acid. InChIKey: NNYBQONXHNTVIJ-HXDATLCLSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 291.38 g/mol |
| IUPAC name | 2-[(1R)-3,3,4,4-tetradeuterio-1,8-diethyl-9H-pyrano[3,4-b]indol-1-yl]acetic acid |
| InChIKey | NNYBQONXHNTVIJ-HXDATLCLSA-N |
| SMILES | [2H]C1(C2=C([C@@](OC1([2H])[2H])(CC)CC(=O)O)NC3=C(C=CC=C23)CC)[2H] |
Computed by PubChem (NCBI)