Products 1276197-46-6
CAS 1276197-46-6 appears in our catalog under these names: rac Etodolac-d3, >95% (HPLC), (±)-Etodolac-d3 (1-ethyl-2,2,2-d3), 99 atom % D, min 98% Chemical Purity, rac Etodolac-d3, (rac)-Etodolac-d3. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 25mg, 5mg, 50mg, 1 mg.
2-[8-ethyl-1-(2,2,2-trideuterioethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid (CAS 1276197-46-6) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 290.37 g/mol. IUPAC name: 2-[8-ethyl-1-(2,2,2-trideuterioethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid. InChIKey: NNYBQONXHNTVIJ-BMSJAHLVSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 290.37 g/mol |
| IUPAC name | 2-[8-ethyl-1-(2,2,2-trideuterioethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid |
| InChIKey | NNYBQONXHNTVIJ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])CC1(C2=C(CCO1)C3=CC=CC(=C3N2)CC)CC(=O)O |
Computed by PubChem (NCBI)