CAS 1246815-33-7 is the registry number for (R)-(-)-Etodolac-d3. Offered by: TRC. Available pack sizes: 5mg.
2-[(1R)-8-ethyl-1-(2,2,2-trideuterioethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid (CAS 1246815-33-7) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 290.37 g/mol. IUPAC name: 2-[(1R)-8-ethyl-1-(2,2,2-trideuterioethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid. InChIKey: NNYBQONXHNTVIJ-NVNSKBCASA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 290.37 g/mol |
| IUPAC name | 2-[(1R)-8-ethyl-1-(2,2,2-trideuterioethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid |
| InChIKey | NNYBQONXHNTVIJ-NVNSKBCASA-N |
| SMILES | [2H]C([2H])([2H])C[C@]1(C2=C(CCO1)C3=CC=CC(=C3N2)CC)CC(=O)O |
Computed by PubChem (NCBI)