Products 1432057-38-9
CAS 1432057-38-9 appears in our catalog under these names: Ramelteon–d3, Ramelteon-d3, 99%, 99%, Ramelteon-d3, 99.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 5 mg, 1 mg.
3,3,3-trideuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 1432057-38-9) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 262.36 g/mol. IUPAC name: 3,3,3-trideuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: YLXDSYKOBKBWJQ-JHFOHIRNSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 262.36 g/mol |
| IUPAC name | 3,3,3-trideuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | YLXDSYKOBKBWJQ-JHFOHIRNSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)