Products 1185146-24-0
CAS 1185146-24-0 appears in our catalog under these names: rac Ramelteon-d3, >95% (HPLC), (Rac)-Remelteon-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3,3,3-trideuterio-N-[2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)ethyl]propanamide (CAS 1185146-24-0) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 262.36 g/mol. IUPAC name: 3,3,3-trideuterio-N-[2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)ethyl]propanamide. InChIKey: YLXDSYKOBKBWJQ-FIBGUPNXSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 262.36 g/mol |
| IUPAC name | 3,3,3-trideuterio-N-[2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)ethyl]propanamide |
| InChIKey | YLXDSYKOBKBWJQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)NCCC1CCC2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)