Products 1134380-74-7
CAS 1134380-74-7 appears in our catalog under these names: 3-Amino-3'-nitrobiphenyl hydrochloride, 95%, 3'-Nitro-(1,1'-biphenyl)-3-amine hydrochloride, 98%, 3-Amino-3'-nitrobiphenyl hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
3-(3-nitrophenyl)aniline;hydrochloride (CAS 1134380-74-7) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 3-(3-nitrophenyl)aniline;hydrochloride. InChIKey: MHZOSKXDMKLLOZ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 3-(3-nitrophenyl)aniline;hydrochloride |
| InChIKey | MHZOSKXDMKLLOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=CC=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)