CAS 852839-94-2 appears in our catalog under these names: 3–Amino–4–chloro–N–(2–furylmethyl)benzamide, 3-Amino-4-chloro-n-(2-furylmethyl)benzamide, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
3-amino-4-chloro-N-(furan-2-ylmethyl)benzamide (CAS 852839-94-2) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 3-amino-4-chloro-N-(furan-2-ylmethyl)benzamide. InChIKey: RPJRPRMXOSCORN-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 3-amino-4-chloro-N-(furan-2-ylmethyl)benzamide |
| InChIKey | RPJRPRMXOSCORN-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)