CAS 113808-87-0 appears in our catalog under these names: 1-(4-Chlorophenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Chloro-phenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 1g, 5g, 0,5g.
1-(4-chlorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 113808-87-0) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: LMIAUFPOUMFDJB-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | LMIAUFPOUMFDJB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)Cl)C)C(=O)O |
Computed by PubChem (NCBI)