CAS 620957-95-1 is the registry number for Ethyl 4-chloro-6-methyl-2-quinazolinecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-chloro-6-methylquinazoline-2-carboxylate (CAS 620957-95-1) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: ethyl 4-chloro-6-methylquinazoline-2-carboxylate. InChIKey: NZKXQPUEYVPGPX-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | ethyl 4-chloro-6-methylquinazoline-2-carboxylate |
| InChIKey | NZKXQPUEYVPGPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C(C=C2)C)C(=N1)Cl |
Computed by PubChem (NCBI)