CAS 1134524-25-6 appears in our catalog under these names: 1–(4–fluorophenyl)cyclopropan–1–amine hydrochloride, 1-(4-Fluorophenyl)cyclopropanamine, 1-(4-Fluorophenyl)cyclopropanamine hydrochloride 96%, 1-(4-Fluorophenyl)cyclopropan-1-amine hydrochloride, 96%, 96%, 1-(4-Fluorophenyl)cyclopropan-1-amine hydrochloride, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g.
1-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1134524-25-6) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 1-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: JYCQXHLHNSOVLC-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 1-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | JYCQXHLHNSOVLC-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)