Products 113502-52-6
CAS 113502-52-6 appears in our catalog under these names: Ketorolac Related Compound C, Ketorolac EP Impurity B, 1-Keto Ketorolac, >95% (HPLC), 5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one (Ketorolac 1-Keto Analog), 1-Keto-ketorolac. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg.
5-benzoyl-2,3-dihydropyrrolizin-1-one (CAS 113502-52-6) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 5-benzoyl-2,3-dihydropyrrolizin-1-one. InChIKey: NFKBMHXYCKRXPQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 5-benzoyl-2,3-dihydropyrrolizin-1-one |
| InChIKey | NFKBMHXYCKRXPQ-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC=C2C(=O)C3=CC=CC=C3)C1=O |
Computed by PubChem (NCBI)
Synonyms:
5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one, 1H-Pyrrolizin-1-one, 5-benzoyl-2,3-dihydro-, Ketorolac trometamol specified impurity B [EP], KETOROLAC TROMETAMOL IMPURITY B [EP IMPURITY], KETOROLAC TROMETAMOL IMPURITY B (EP IMPURITY), Ketorolac tromethamine impurity, ketorolac 1-keto analog-(USP), Ketorolac tromethamine impurity, ketorolac 1-keto analog-[USP], Ketorolac trometamol specified impurity B, 1-Keto Ketorolac, Ketorolac EP Impurity B