Products 1135219-29-2

CAS 1135219-29-2 is the registry number for Ethyl 2-amino-2-ethylbutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-2-ethylbutanoate;hydrochloride (CAS 1135219-29-2) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl 2-amino-2-ethylbutanoate;hydrochloride. InChIKey: GQERJQAZXHCDQN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO2
Molecular weight195.69 g/mol
IUPAC nameethyl 2-amino-2-ethylbutanoate;hydrochloride
InChIKeyGQERJQAZXHCDQN-UHFFFAOYSA-N
SMILESCCC(CC)(C(=O)OCC)N.Cl

Computed by PubChem (NCBI)