CAS 1135283-20-3 appears in our catalog under these names: 1-tert-Butyl 2-ethyl 3-bromo-1H-indole-1,2-dicarboxylate, 95+%, 1-tert-Butyl 2-ethyl 3-bromo-1H-indole-1,2-dicarboxylate, 98%, 98%, 1-(Tert-butyl) 2-ethyl 3-bromo-1H-indole-1,2-dicarboxylate, 95+%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-O-tert-butyl 2-O-ethyl 3-bromoindole-1,2-dicarboxylate (CAS 1135283-20-3) is a chemical compound with the molecular formula C16H18BrNO4 and a molecular weight of 368.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 3-bromoindole-1,2-dicarboxylate. InChIKey: NBLDBHBAGSIPOU-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO4 |
|---|---|
| Molecular weight | 368.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 3-bromoindole-1,2-dicarboxylate |
| InChIKey | NBLDBHBAGSIPOU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2N1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)