CAS 16659-88-4 appears in our catalog under these names: Norlaudanosoline Hydrobromide, >95% (HPLC), Norlaudanosoline HBr, Tetrahydropapaveroline (hydrobromide), 99.84%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 250mg, 1 mg, 10 mg, 5 mg.
1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide (CAS 16659-88-4) is a chemical compound with the molecular formula C16H18BrNO4 and a molecular weight of 368.22 g/mol. IUPAC name: 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide. InChIKey: WAADYLVPNMRUKN-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO4 |
|---|---|
| Molecular weight | 368.22 g/mol |
| IUPAC name | 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
| InChIKey | WAADYLVPNMRUKN-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC(=C(C=C3)O)O.Br |
Computed by PubChem (NCBI)