CAS 1456724-57-4 is the registry number for tert-Butyl 7'-bromo-4'-oxospiro[azetidine-3,2'-chroman]-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-bromo-4-oxospiro[3H-chromene-2,3'-azetidine]-1'-carboxylate (CAS 1456724-57-4) is a chemical compound with the molecular formula C16H18BrNO4 and a molecular weight of 368.22 g/mol. IUPAC name: tert-butyl 7-bromo-4-oxospiro[3H-chromene-2,3'-azetidine]-1'-carboxylate. InChIKey: NOTOWVSJUKCICQ-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO4 |
|---|---|
| Molecular weight | 368.22 g/mol |
| IUPAC name | tert-butyl 7-bromo-4-oxospiro[3H-chromene-2,3'-azetidine]-1'-carboxylate |
| InChIKey | NOTOWVSJUKCICQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(=O)C3=C(O2)C=C(C=C3)Br |
Computed by PubChem (NCBI)