CAS 1192127-84-6 is the registry number for Ethyl 6-bromo-4-oxospiro[chromane-2,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CAS 1192127-84-6) is a chemical compound with the molecular formula C16H18BrNO4 and a molecular weight of 368.22 g/mol. IUPAC name: ethyl 6-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate. InChIKey: LOFNYZJIMYWYJD-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO4 |
|---|---|
| Molecular weight | 368.22 g/mol |
| IUPAC name | ethyl 6-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | LOFNYZJIMYWYJD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC2(CC1)CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)