CAS 1135283-30-5 is the registry number for 6-Bromo-3-(2,2,2-trifluoroethyl)-4(3h)-quinazolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-3-(2,2,2-trifluoroethyl)quinazolin-4-one (CAS 1135283-30-5) is a chemical compound with the molecular formula C10H6BrF3N2O and a molecular weight of 307.07 g/mol. IUPAC name: 6-bromo-3-(2,2,2-trifluoroethyl)quinazolin-4-one. InChIKey: QFZOSUVYVRLTRW-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3N2O |
|---|---|
| Molecular weight | 307.07 g/mol |
| IUPAC name | 6-bromo-3-(2,2,2-trifluoroethyl)quinazolin-4-one |
| InChIKey | QFZOSUVYVRLTRW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)N(C=N2)CC(F)(F)F |
Computed by PubChem (NCBI)