Products 1153042-94-4
CAS 1153042-94-4 is the registry number for 1-(2-Bromophenyl)-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-bromophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-one (CAS 1153042-94-4) is a chemical compound with the molecular formula C10H6BrF3N2O and a molecular weight of 307.07 g/mol. IUPAC name: 2-(2-bromophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-one. InChIKey: FDWWIJXAQOVGMY-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3N2O |
|---|---|
| Molecular weight | 307.07 g/mol |
| IUPAC name | 2-(2-bromophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-one |
| InChIKey | FDWWIJXAQOVGMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=O)C=C(N2)C(F)(F)F)Br |
Computed by PubChem (NCBI)