Products 2756334-20-8
CAS 2756334-20-8 is the registry number for 7-Bromo-3-(1,1-difluoroethyl)-8-fluoroquinoxalin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3-(1,1-difluoroethyl)-8-fluoro-1H-quinoxalin-2-one (CAS 2756334-20-8) is a chemical compound with the molecular formula C10H6BrF3N2O and a molecular weight of 307.07 g/mol. IUPAC name: 7-bromo-3-(1,1-difluoroethyl)-8-fluoro-1H-quinoxalin-2-one. InChIKey: MXAUWFROFCMEPH-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3N2O |
|---|---|
| Molecular weight | 307.07 g/mol |
| IUPAC name | 7-bromo-3-(1,1-difluoroethyl)-8-fluoro-1H-quinoxalin-2-one |
| InChIKey | MXAUWFROFCMEPH-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(C(=C(C=C2)Br)F)NC1=O)(F)F |
Computed by PubChem (NCBI)