Products 1565779-84-1
CAS 1565779-84-1 appears in our catalog under these names: 4-Bromo-6-methoxy-2-(trifluoromethyl)-1,5-naphthyridine, 95%, 4-Bromo-6-methoxy-2-(trifluoromethyl)-1,5-naphthyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-bromo-6-methoxy-2-(trifluoromethyl)-1,5-naphthyridine (CAS 1565779-84-1) is a chemical compound with the molecular formula C10H6BrF3N2O and a molecular weight of 307.07 g/mol. IUPAC name: 4-bromo-6-methoxy-2-(trifluoromethyl)-1,5-naphthyridine. InChIKey: UQVSTQTZZCPDRG-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3N2O |
|---|---|
| Molecular weight | 307.07 g/mol |
| IUPAC name | 4-bromo-6-methoxy-2-(trifluoromethyl)-1,5-naphthyridine |
| InChIKey | UQVSTQTZZCPDRG-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=C(C=C2Br)C(F)(F)F |
Computed by PubChem (NCBI)