Products 1135310-02-9
CAS 1135310-02-9 is the registry number for rac-(3R,4S)-4-phenylpyrrolidin-3-ol hydrochloride, trans, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3S,4R)-4-phenylpyrrolidin-3-ol;hydrochloride (CAS 1135310-02-9) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (3S,4R)-4-phenylpyrrolidin-3-ol;hydrochloride. InChIKey: PXQNESYPIZUPHU-BAUSSPIASA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (3S,4R)-4-phenylpyrrolidin-3-ol;hydrochloride |
| InChIKey | PXQNESYPIZUPHU-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)