CAS 113546-63-7 is the registry number for 2-(1,3-Benzoxazol-2-ylsulfanyl)acetohydrazide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(1,3-benzoxazol-2-ylsulfanyl)acetohydrazide (CAS 113546-63-7) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-ylsulfanyl)acetohydrazide. InChIKey: LJEBGZZNJLKPEG-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-ylsulfanyl)acetohydrazide |
| InChIKey | LJEBGZZNJLKPEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)SCC(=O)NN |
Computed by PubChem (NCBI)