CAS 113571-08-7 is the registry number for 5-Chloro-2,4-dimethyl-benzothiazole. Offered by: TRC. Available pack sizes: 1g.
5-chloro-2,4-dimethyl-1,3-benzothiazole (CAS 113571-08-7) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 5-chloro-2,4-dimethyl-1,3-benzothiazole. InChIKey: BJVQVGMXNPQBMK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 5-chloro-2,4-dimethyl-1,3-benzothiazole |
| InChIKey | BJVQVGMXNPQBMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(S2)C)Cl |
Computed by PubChem (NCBI)