CAS 1188046-08-3 is the registry number for 2-Chloro-6,7-dimethylbenzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-6,7-dimethyl-1,3-benzothiazole (CAS 1188046-08-3) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 2-chloro-6,7-dimethyl-1,3-benzothiazole. InChIKey: XVEOYOLNKBLHEJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 2-chloro-6,7-dimethyl-1,3-benzothiazole |
| InChIKey | XVEOYOLNKBLHEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=C(S2)Cl)C |
Computed by PubChem (NCBI)