Products 1135821-47-4
CAS 1135821-47-4 is the registry number for 5-(3-Bromophenyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
3-(3-bromophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1135821-47-4) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 3-(3-bromophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: OWLGITCDNHDLLY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | OWLGITCDNHDLLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)