CAS 113625-73-3 is the registry number for (1R,2R)-2-(Benzyloxy)cyclopentan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2R)-2-phenylmethoxycyclopentan-1-ol (CAS 113625-73-3) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: trans-(1R,2R)-2-phenylmethoxycyclopentan-1-ol. InChIKey: ZLAPGVQTWHCDPT-VXGBXAGGSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | trans-(1R,2R)-2-phenylmethoxycyclopentan-1-ol |
| InChIKey | ZLAPGVQTWHCDPT-VXGBXAGGSA-N |
| SMILES | C1C[C@H]([C@@H](C1)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)