CAS 135356-97-7 is the registry number for (1S,2S)-2-(Benzyloxy)cyclopentan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1S,2S)-2-phenylmethoxycyclopentan-1-ol (CAS 135356-97-7) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: trans-(1S,2S)-2-phenylmethoxycyclopentan-1-ol. InChIKey: ZLAPGVQTWHCDPT-RYUDHWBXSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | trans-(1S,2S)-2-phenylmethoxycyclopentan-1-ol |
| InChIKey | ZLAPGVQTWHCDPT-RYUDHWBXSA-N |
| SMILES | C1C[C@@H]([C@H](C1)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)