Products 113642-05-0

CAS 113642-05-0 is the registry number for Methyl 3-bromo-4-ethylbenzoate 95%. Offered by: Ambeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-4-ethylbenzoate (CAS 113642-05-0) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 3-bromo-4-ethylbenzoate. InChIKey: WSYKXUBTLUYUSD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO2
Molecular weight243.10 g/mol
IUPAC namemethyl 3-bromo-4-ethylbenzoate
InChIKeyWSYKXUBTLUYUSD-UHFFFAOYSA-N
SMILESCCC1=C(C=C(C=C1)C(=O)OC)Br

Computed by PubChem (NCBI)