CAS 113642-05-0 is the registry number for Methyl 3-bromo-4-ethylbenzoate 95%. Offered by: Ambeed. Available pack sizes: 1g.
Methyl 3-bromo-4-ethylbenzoate (CAS 113642-05-0) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 3-bromo-4-ethylbenzoate. InChIKey: WSYKXUBTLUYUSD-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 3-bromo-4-ethylbenzoate |
| InChIKey | WSYKXUBTLUYUSD-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)