CAS 113728-13-5 appears in our catalog under these names: H-Gly-amc hbr, 95%, 2–Amino–N–(4–methyl–2–oxo–2H–chromen–7–yl)acetamide hydrobromide, Glycine 7-amido-4-methylcoumarin hydrobromide, H-Gly-amc hbr 98%, 2-Amino-N-(4-methyl-2-oxo-2H-chromen-7-yl)acetamide hydrobromide, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 2g, 5g, 10g.
2-amino-N-(4-methyl-2-oxochromen-7-yl)acetamide;hydrobromide (CAS 113728-13-5) is a chemical compound with the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. IUPAC name: 2-amino-N-(4-methyl-2-oxochromen-7-yl)acetamide;hydrobromide. InChIKey: NNHMGPIGAMTPDU-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O3 |
|---|---|
| Molecular weight | 313.15 g/mol |
| IUPAC name | 2-amino-N-(4-methyl-2-oxochromen-7-yl)acetamide;hydrobromide |
| InChIKey | NNHMGPIGAMTPDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)CN.Br |
Computed by PubChem (NCBI)