Products 941294-21-9
CAS 941294-21-9 appears in our catalog under these names: 1-(3-Bromo-5-nitrobenzoyl)piperidine, 98%, (3-Bromo-5-nitrophenyl)(piperidin-1-yl)methanone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g.
(3-bromo-5-nitrophenyl)-piperidin-1-ylmethanone (CAS 941294-21-9) is a chemical compound with the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. IUPAC name: (3-bromo-5-nitrophenyl)-piperidin-1-ylmethanone. InChIKey: KMSPUVJLWOBQCG-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O3 |
|---|---|
| Molecular weight | 313.15 g/mol |
| IUPAC name | (3-bromo-5-nitrophenyl)-piperidin-1-ylmethanone |
| InChIKey | KMSPUVJLWOBQCG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=CC(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)