Products 161468-53-7
CAS 161468-53-7 is the registry number for tert-Butyl 6-bromo-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-bromo-2-oxo-3H-benzimidazole-1-carboxylate (CAS 161468-53-7) is a chemical compound with the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. IUPAC name: tert-butyl 6-bromo-2-oxo-3H-benzimidazole-1-carboxylate. InChIKey: RJGRJBMPQWSZKL-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O3 |
|---|---|
| Molecular weight | 313.15 g/mol |
| IUPAC name | tert-butyl 6-bromo-2-oxo-3H-benzimidazole-1-carboxylate |
| InChIKey | RJGRJBMPQWSZKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CC(=C2)Br)NC1=O |
Computed by PubChem (NCBI)