Products 941294-18-4
CAS 941294-18-4 appears in our catalog under these names: N-Cyclopentyl 3-bromo-5-nitrobenzamide, 97%, 3-Bromo-N-cyclopentyl-5-nitrobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
3-bromo-N-cyclopentyl-5-nitrobenzamide (CAS 941294-18-4) is a chemical compound with the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. IUPAC name: 3-bromo-N-cyclopentyl-5-nitrobenzamide. InChIKey: LBQLJGUFWGRRPS-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O3 |
|---|---|
| Molecular weight | 313.15 g/mol |
| IUPAC name | 3-bromo-N-cyclopentyl-5-nitrobenzamide |
| InChIKey | LBQLJGUFWGRRPS-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CC(=CC(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)