CAS 113806-28-3 is the registry number for (2R,4S)-3-Benzoyl-4-methyl-2-phenyl-5-oxazolidinone. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one (CAS 113806-28-3) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one. InChIKey: XWBOGYZALFWLOF-BLLLJJGKSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one |
| InChIKey | XWBOGYZALFWLOF-BLLLJJGKSA-N |
| SMILES | C[C@H]1C(=O)O[C@@H](N1C(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)