CAS 1138245-15-4 appears in our catalog under these names: Enantiomer of mirogabalin, 95%, Mirogabalin Impurity 7, (1S,5R,6R)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-ene-6-acetic acid, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 250mg, 1g, on request, 10mg, 25mg.
2-[(1S,5R,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (CAS 1138245-15-4) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: 2-[(1S,5R,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid. InChIKey: FTBQORVNHOIASH-NHCYSSNCSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | 2-[(1S,5R,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| InChIKey | FTBQORVNHOIASH-NHCYSSNCSA-N |
| SMILES | CCC1=C[C@H]2[C@@H](C1)C[C@]2(CC(=O)O)CN |
Computed by PubChem (NCBI)