Products 2166206-19-3
CAS 2166206-19-3 appears in our catalog under these names: Mirogabalin Impurity 14, Mirogabalin Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1R,5S,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (CAS 2166206-19-3) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: 2-[(1R,5S,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid. InChIKey: FTBQORVNHOIASH-FOGDFJRCSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | 2-[(1R,5S,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| InChIKey | FTBQORVNHOIASH-FOGDFJRCSA-N |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@]2(CC(=O)O)CN |
Computed by PubChem (NCBI)