Products 2165847-73-2

CAS 2165847-73-2 appears in our catalog under these names: Mirogabalin Impurity 6, Mirogabalin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(1S,5R,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (CAS 2165847-73-2) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: 2-[(1S,5R,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid. InChIKey: FTBQORVNHOIASH-JBLDHEPKSA-N.

Identity
Molecular formulaC12H19NO2
Molecular weight209.28 g/mol
IUPAC name2-[(1S,5R,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid
InChIKeyFTBQORVNHOIASH-JBLDHEPKSA-N
SMILESCCC1=C[C@H]2[C@@H](C1)C[C@@]2(CC(=O)O)CN

Computed by PubChem (NCBI)