CAS 1138463-56-5 appears in our catalog under these names: Paliperidone Impurity 5, Paliperidone Impurity 28, Paliperidone Impurity 17, 3-(2-Chloroethyl)-7,8-dihydro-2-methyl-4H-pyrido(1,2-a)pyrimidine-4,9(6H)-dione, >95% (GC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
3-(2-chloroethyl)-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione (CAS 1138463-56-5) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 3-(2-chloroethyl)-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione. InChIKey: VGPXOUAVKJQFNG-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 3-(2-chloroethyl)-2-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-4,9-dione |
| InChIKey | VGPXOUAVKJQFNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2CCCC(=O)C2=N1)CCCl |
Computed by PubChem (NCBI)