CAS 113875-06-2 is the registry number for N'-(Thiophen-2-ylmethylene)cyclopropanecarbohydrazide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
N-[(E)-thiophen-2-ylmethylideneamino]cyclopropanecarboxamide (CAS 113875-06-2) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: N-[(E)-thiophen-2-ylmethylideneamino]cyclopropanecarboxamide. InChIKey: WQCIBERJKZYXCC-UXBLZVDNSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | N-[(E)-thiophen-2-ylmethylideneamino]cyclopropanecarboxamide |
| InChIKey | WQCIBERJKZYXCC-UXBLZVDNSA-N |
| SMILES | C1CC1C(=O)N/N=C/C2=CC=CS2 |
Computed by PubChem (NCBI)