Products 113898-97-8
CAS 113898-97-8 is the registry number for Cinnamyl 3–aminobut–2–enoate. Offered by: GLPBio. Available pack sizes: 5mg.
[(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate (CAS 113898-97-8) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: [(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate. InChIKey: GOWWDIWBLHYGMJ-GZPHBSKSSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate |
| InChIKey | GOWWDIWBLHYGMJ-GZPHBSKSSA-N |
| SMILES | C/C(=C/C(=O)OC/C=C/C1=CC=CC=C1)/N |
Computed by PubChem (NCBI)
Synonyms:
(E)-Cinnamyl 3-aminobut-2-enoate, 3-Amino Crotonic Acid Cinnamyl Ester, Cinnamyl 3-aminobut-2-enoate, [(E)-3-phenylprop-2-enyl] (Z)-3-aminobut-2-enoate, Cinnamyl 3-Aminocrotonate, 3-Phenylallyl 3-aminobut-2-enoate, Cilnidipine Impurity 12, (E)-Cinnamyl3-aminobut-2-enoate, (E)-cinnamyl (Z)-3-aminobut-2-enoate, [(E)-cinnamyl] (Z)-3-aminobut-2-enoate