CAS 134106-41-5 appears in our catalog under these names: (E)-Cinnamyl 3-aminobut-2-enoate, 97%, (2E)-3-PHenyl-2-propen-1-yl (2E)-3-amino-2-butenoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
[(E)-3-phenylprop-2-enyl] (E)-3-aminobut-2-enoate (CAS 134106-41-5) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: [(E)-3-phenylprop-2-enyl] (E)-3-aminobut-2-enoate. InChIKey: GOWWDIWBLHYGMJ-JBSGUNFDSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enyl] (E)-3-aminobut-2-enoate |
| InChIKey | GOWWDIWBLHYGMJ-JBSGUNFDSA-N |
| SMILES | C/C(=C\C(=O)OC/C=C/C1=CC=CC=C1)/N |
Computed by PubChem (NCBI)