CAS 1140948-95-3 is the registry number for Benzyl N-((2S)-1-(chlorosulfonyl)propan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Benzyl N-[(2S)-1-chlorosulfonylpropan-2-yl]carbamate (CAS 1140948-95-3) is a chemical compound with the molecular formula C11H14ClNO4S and a molecular weight of 291.75 g/mol. IUPAC name: benzyl N-[(2S)-1-chlorosulfonylpropan-2-yl]carbamate. InChIKey: NIHFPICSMSDBCI-VIFPVBQESA-N.
| Molecular formula | C11H14ClNO4S |
|---|---|
| Molecular weight | 291.75 g/mol |
| IUPAC name | benzyl N-[(2S)-1-chlorosulfonylpropan-2-yl]carbamate |
| InChIKey | NIHFPICSMSDBCI-VIFPVBQESA-N |
| SMILES | C[C@@H](CS(=O)(=O)Cl)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)