CAS 1784671-22-2 is the registry number for Benzyl N-(1-(chlorosulfonyl)propan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Benzyl N-(1-chlorosulfonylpropan-2-yl)carbamate (CAS 1784671-22-2) is a chemical compound with the molecular formula C11H14ClNO4S and a molecular weight of 291.75 g/mol. IUPAC name: benzyl N-(1-chlorosulfonylpropan-2-yl)carbamate. InChIKey: NIHFPICSMSDBCI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4S |
|---|---|
| Molecular weight | 291.75 g/mol |
| IUPAC name | benzyl N-(1-chlorosulfonylpropan-2-yl)carbamate |
| InChIKey | NIHFPICSMSDBCI-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)Cl)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)