Products 114099-96-6
CAS 114099-96-6 appears in our catalog under these names: Fraision butyrate, 95%, 4,5-Dihydro-2,5-dimethyl-4-oxofuran-3-yl Butyrate, 96% GC, 4,5–Dihydro–2,5–dimethyl–4–oxofuran–3–yl Butyrate, 2,5-dimethyl-4-oxo-4,5-dihydrofuran-3-yl butanoate, 98%, 98%, 5-methyl-2-methylidene-4-oxooxolan-3-yl butanoate, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g, 10g.
(2,5-dimethyl-4-oxofuran-3-yl) butanoate (CAS 114099-96-6) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (2,5-dimethyl-4-oxofuran-3-yl) butanoate. InChIKey: JOLGAERKCZYHLF-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2,5-dimethyl-4-oxofuran-3-yl) butanoate |
| InChIKey | JOLGAERKCZYHLF-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=C(OC(C1=O)C)C |
Computed by PubChem (NCBI)
Synonyms:
furaneyl butyrate, Butanoic acid, 4,5-dihydro-2,5-dimethyl-4-oxo-3-furanyl ester, FEMA No. 3970, 2,5-Dimethyl-3-oxo-(2H)-fur-4-yl butyrate, 2,5-Dimethyl-3-oxo-(2H)-fur-4-yl butyrate [FIFH], 2,5-Dimethyl-3-oxo-(2H)-fur-4-yl butyrate (FIFH), 4,5-Dihydro-2,5-dimethyl-4-oxofuran-3-yl Butyrate, 2,5-dimethyl-4-oxo-4,5-dihydrofuran-3-yl butanoate, (2,5-dimethyl-4-oxofuran-3-yl) butanoate, FRAISION BUTYRATE