CAS 1141738-08-0 is the registry number for BZP–d7 (hydrochloride) (CRM). Offered by: GLPBio. Available pack sizes: 100μg.
1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazine;dihydrochloride (CAS 1141738-08-0) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 256.22 g/mol. IUPAC name: 1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazine;dihydrochloride. InChIKey: BBUJLUKPBBBXMU-JQGXLDKISA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | 1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]piperazine;dihydrochloride |
| InChIKey | BBUJLUKPBBBXMU-JQGXLDKISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])N2CCNCC2)[2H])[2H].Cl.Cl |
Computed by PubChem (NCBI)