Products 1141931-86-3
CAS 1141931-86-3 is the registry number for 1,4-Bis((1S)-1-(4-methoxyphenyl)ethyl)-2,5-piperazinedione. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1,4-bis[(1S)-1-(4-methoxyphenyl)ethyl]piperazine-2,5-dione (CAS 1141931-86-3) is a chemical compound with the molecular formula C22H26N2O4 and a molecular weight of 382.5 g/mol. IUPAC name: 1,4-bis[(1S)-1-(4-methoxyphenyl)ethyl]piperazine-2,5-dione. InChIKey: IVDJXQRJJUZUSU-HOTGVXAUSA-N.
| Molecular formula | C22H26N2O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 1,4-bis[(1S)-1-(4-methoxyphenyl)ethyl]piperazine-2,5-dione |
| InChIKey | IVDJXQRJJUZUSU-HOTGVXAUSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC)N2CC(=O)N(CC2=O)[C@@H](C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)