CAS 166410-28-2 appears in our catalog under these names: (9H-Fluoren-9-yl)methyl tert-butyl ethane-1,2-diyldicarbamate, 95%, (9H–Fluoren–9–yl)methyl tert–butyl ethane–1,2–diyldicarbamate, FmocNH-C2-BocNH 97%, N-(tert-Butyloxycarbonyl)-N′-(9-fluorenylmethoxycarbonyl)ethylenediamine, 97%, 97%, (9H-Fluoren-9-yl)methyl tert-butyl ethane-1,2-diyldicarbamate, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 1 g.
Tert-butyl N-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]carbamate (CAS 166410-28-2) is a chemical compound with the molecular formula C22H26N2O4 and a molecular weight of 382.5 g/mol. IUPAC name: tert-butyl N-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]carbamate. InChIKey: LPCNXVJXDPVSMA-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | tert-butyl N-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]carbamate |
| InChIKey | LPCNXVJXDPVSMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)