Products 163860-35-3
CAS 163860-35-3 is the registry number for Tebufenozide-acetic acid. Offered by: Dr. Ehrenstorfer. Available pack sizes: 25mg.
2-[4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]acetic acid (CAS 163860-35-3) is a chemical compound with the molecular formula C22H26N2O4 and a molecular weight of 382.5 g/mol. IUPAC name: 2-[4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]acetic acid. InChIKey: QWBPAVBETVFMQN-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-[4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]acetic acid |
| InChIKey | QWBPAVBETVFMQN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=CC=C(C=C2)CC(=O)O)C |
Computed by PubChem (NCBI)