CAS 88191-84-8 appears in our catalog under these names: MDL 28170, MDL-28170, MDL 28170, Calpain Inhibitor III, 95+% , Calpain Inhibitor III. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 500mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
Benzyl N-[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]carbamate (CAS 88191-84-8) is a chemical compound with the molecular formula C22H26N2O4 and a molecular weight of 382.5 g/mol. IUPAC name: benzyl N-[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]carbamate. InChIKey: NGBKFLTYGSREKK-ANYOKISRSA-N.
| Molecular formula | C22H26N2O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | benzyl N-[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]carbamate |
| InChIKey | NGBKFLTYGSREKK-ANYOKISRSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC(CC1=CC=CC=C1)C=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)